C15H22N4O4S — CID 30892596
N-[2-(dimethylamino)-2-oxoethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 30892596) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 30892596 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CN(C)C(=O)CNC(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C15H22N4O4S/c1-18(2)14(20)11-17-15(21)12-5-8-19(9-6-12)24(22,23)13-4-3-7-16-10-13/h3-4,7,10,12H,5-6,8-9,11H2,1-2H3,(H,17,21) |
| InChIKey | RRPCTAGDQYIEHH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |