C19H29N3O5S — CID 46602604
[2-[di(propan-2-yl)amino]-2-oxoethyl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate (PubChem CID 46602604) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is [2-[di(propan-2-yl)amino]-2-oxoethyl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46602604 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)N(C(=O)COC(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1)C(C)C |
| InChI | InChI=1S/C19H29N3O5S/c1-14(2)22(15(3)4)18(23)13-27-19(24)16-7-10-21(11-8-16)28(25,26)17-6-5-9-20-12-17/h5-6,9,12,14-16H,7-8,10-11,13H2,1-4H3 |
| InChIKey | ZWVJJBIFSLUBOT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |