C20H24N2O5S — CID 46602851
2-(4-methylphenoxy)ethyl 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate (PubChem CID 46602851) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(4-methylphenoxy)ethyl 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46602851 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc(OCCOC(=O)C2CCN(S(=O)(=O)c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-16-4-6-18(7-5-16)26-13-14-27-20(23)17-8-11-22(12-9-17)28(24,25)19-3-2-10-21-15-19/h2-7,10,15,17H,8-9,11-14H2,1H3 |
| InChIKey | FBSUGLLQLCVNBJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|