C19H23NO5S2 — CID 7843741
2-(4-methylphenoxy)ethyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate (PubChem CID 7843741) has the molecular formula C19H23NO5S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(4-methylphenoxy)ethyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 7843741 |
| Molecular Formula | C19H23NO5S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc(OCCOC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C19H23NO5S2/c1-15-4-6-17(7-5-15)24-12-13-25-19(21)16-8-10-20(11-9-16)27(22,23)18-3-2-14-26-18/h2-7,14,16H,8-13H2,1H3 |
| InChIKey | GDGHMSDFLBLPBQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|