C20H25NO4S2 — CID 7843819
(4-propan-2-ylphenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate (PubChem CID 7843819) has the molecular formula C20H25NO4S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (4-propan-2-ylphenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | (4-propan-2-ylphenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 7843819 |
| Molecular Formula | C20H25NO4S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (4-propan-2-ylphenyl)methyl 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)c1ccc(COC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C20H25NO4S2/c1-15(2)17-7-5-16(6-8-17)14-25-20(22)18-9-11-21(12-10-18)27(23,24)19-4-3-13-26-19/h3-8,13,15,18H,9-12,14H2,1-2H3 |
| InChIKey | JNKWETYAJYSYPX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |