C22H28N2O5S2 — CID 3341794
[2-(4-butylanilino)-2-oxoethyl] 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate (PubChem CID 3341794) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is [2-(4-butylanilino)-2-oxoethyl] 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | [2-(4-butylanilino)-2-oxoethyl] 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 3341794 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [2-(4-butylanilino)-2-oxoethyl] 1-thiophen-2-ylsulfonylpiperidine-4-carboxylate |
| SMILES | CCCCc1ccc(NC(=O)COC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C22H28N2O5S2/c1-2-3-5-17-7-9-19(10-8-17)23-20(25)16-29-22(26)18-11-13-24(14-12-18)31(27,28)21-6-4-15-30-21/h4,6-10,15,18H,2-3,5,11-14,16H2,1H3,(H,23,25) |
| InChIKey | MJBRASXEEMJHFN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |