C23H26N2O4S — CID 29321290
(4-cyanophenyl)methyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 29321290) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (4-cyanophenyl)methyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 29321290 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (4-cyanophenyl)methyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCC(C(=O)OCc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H26N2O4S/c1-17(2)20-7-9-22(10-8-20)30(27,28)25-13-11-21(12-14-25)23(26)29-16-19-5-3-18(15-24)4-6-19/h3-10,17,21H,11-14,16H2,1-2H3 |
| InChIKey | OPHFVBTXARNEJJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |