C22H24N2O5S — CID 26704386
(4-propoxyphenyl) 1-(4-cyanophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 26704386) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is (4-propoxyphenyl) 1-(4-cyanophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (4-propoxyphenyl) 1-(4-cyanophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 26704386 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (4-propoxyphenyl) 1-(4-cyanophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCCOc1ccc(OC(=O)C2CCN(S(=O)(=O)c3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H24N2O5S/c1-2-15-28-19-5-7-20(8-6-19)29-22(25)18-11-13-24(14-12-18)30(26,27)21-9-3-17(16-23)4-10-21/h3-10,18H,2,11-15H2,1H3 |
| InChIKey | KQCILYWUJYNGAB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|