C22H25NO6S — CID 18287959
(3-acetylphenyl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 18287959) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is (3-acetylphenyl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (3-acetylphenyl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 18287959 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (3-acetylphenyl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(C(=O)Oc3cccc(C(C)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C22H25NO6S/c1-3-28-19-7-9-21(10-8-19)30(26,27)23-13-11-17(12-14-23)22(25)29-20-6-4-5-18(15-20)16(2)24/h4-10,15,17H,3,11-14H2,1-2H3 |
| InChIKey | GXZIEOXDOZDRCM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|