C26H27NO7S — CID 31527567
(3-methoxycarbonylnaphthalen-2-yl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 31527567) has the molecular formula C26H27NO7S and a molecular weight of 497.57 g/mol. Its IUPAC name is (3-methoxycarbonylnaphthalen-2-yl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (3-methoxycarbonylnaphthalen-2-yl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 31527567 |
| Molecular Formula | C26H27NO7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | (3-methoxycarbonylnaphthalen-2-yl) 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(C(=O)Oc3cc4ccccc4cc3C(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C26H27NO7S/c1-3-33-21-8-10-22(11-9-21)35(30,31)27-14-12-18(13-15-27)25(28)34-24-17-20-7-5-4-6-19(20)16-23(24)26(29)32-2/h4-11,16-18H,3,12-15H2,1-2H3 |
| InChIKey | QDBFMYDPHZLDJJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|