C21H24N2O6S — CID 1075443
methyl 2-[[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]amino]benzoate (PubChem CID 1075443) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is methyl 2-[[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 1075443 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | methyl 2-[[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CCN(S(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C21H24N2O6S/c1-28-16-7-9-17(10-8-16)30(26,27)23-13-11-15(12-14-23)20(24)22-19-6-4-3-5-18(19)21(25)29-2/h3-10,15H,11-14H2,1-2H3,(H,22,24) |
| InChIKey | ZXVDAIYAVPNMGX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |