C26H26N2O5S — CID 100657242
N-(2-benzoylphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 100657242) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-benzoylphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 100657242 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-(2-benzoylphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccccc3C(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H26N2O5S/c1-33-21-11-13-22(14-12-21)34(31,32)28-17-15-20(16-18-28)26(30)27-24-10-6-5-9-23(24)25(29)19-7-3-2-4-8-19/h2-14,20H,15-18H2,1H3,(H,27,30) |
| InChIKey | VOTJVMMVNVRPQY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |