C27H28N2O5S — CID 16829294
N-(2-benzoyl-4-methylphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 16829294) has the molecular formula C27H28N2O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is N-(2-benzoyl-4-methylphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-benzoyl-4-methylphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16829294 |
| Molecular Formula | C27H28N2O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-(2-benzoyl-4-methylphenyl)-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)Nc3ccc(C)cc3C(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H28N2O5S/c1-19-10-15-25(24(17-19)26(30)20-7-4-3-5-8-20)28-27(31)21-9-6-16-29(18-21)35(32,33)23-13-11-22(34-2)12-14-23/h3-5,7-8,10-15,17,21H,6,9,16,18H2,1-2H3,(H,28,31) |
| InChIKey | SHGFTJDWCWCCPF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |