C25H23ClN2O4S — CID 16862444
1-(benzenesulfonyl)-N-(2-benzoyl-4-chlorophenyl)piperidine-3-carboxamide (PubChem CID 16862444) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(2-benzoyl-4-chlorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(2-benzoyl-4-chlorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 16862444 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(2-benzoyl-4-chlorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NC(=O)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C25H23ClN2O4S/c26-20-13-14-23(22(16-20)24(29)18-8-3-1-4-9-18)27-25(30)19-10-7-15-28(17-19)33(31,32)21-11-5-2-6-12-21/h1-6,8-9,11-14,16,19H,7,10,15,17H2,(H,27,30) |
| InChIKey | DUGOHWWEMMHZFF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |