C18H18F2N2O3S — CID 43872856
1-(benzenesulfonyl)-N-(2,5-difluorophenyl)piperidine-3-carboxamide (PubChem CID 43872856) has the molecular formula C18H18F2N2O3S and a molecular weight of 380.42 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(2,5-difluorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(2,5-difluorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43872856 |
| Molecular Formula | C18H18F2N2O3S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(2,5-difluorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H18F2N2O3S/c19-14-8-9-16(20)17(11-14)21-18(23)13-5-4-10-22(12-13)26(24,25)15-6-2-1-3-7-15/h1-3,6-9,11,13H,4-5,10,12H2,(H,21,23) |
| InChIKey | YCVWPKXXXXVFEZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |