C27H28N2O6S2 — CID 16935172
N-(2-benzoyl-4-methylphenyl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 16935172) has the molecular formula C27H28N2O6S2 and a molecular weight of 540.66 g/mol. Its IUPAC name is N-(2-benzoyl-4-methylphenyl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-benzoyl-4-methylphenyl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16935172 |
| Molecular Formula | C27H28N2O6S2 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | N-(2-benzoyl-4-methylphenyl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccc(S(C)(=O)=O)cc3)CC2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H28N2O6S2/c1-19-8-13-25(24(18-19)26(30)20-6-4-3-5-7-20)28-27(31)21-14-16-29(17-15-21)37(34,35)23-11-9-22(10-12-23)36(2,32)33/h3-13,18,21H,14-17H2,1-2H3,(H,28,31) |
| InChIKey | KQCNUXPVCWLTGC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |