C26H25ClN2O4S2 — CID 16935002
N-(2-benzoyl-4-chlorophenyl)-1-(2-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 16935002) has the molecular formula C26H25ClN2O4S2 and a molecular weight of 529.08 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-1-(2-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-1-(2-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16935002 |
| Molecular Formula | C26H25ClN2O4S2 |
| Molecular Weight | 529.08 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-1-(2-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CSc1ccccc1S(=O)(=O)N1CCC(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H25ClN2O4S2/c1-34-23-9-5-6-10-24(23)35(32,33)29-15-13-19(14-16-29)26(31)28-22-12-11-20(27)17-21(22)25(30)18-7-3-2-4-8-18/h2-12,17,19H,13-16H2,1H3,(H,28,31) |
| InChIKey | JOGVAMKEWWCIOG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.08 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |