C26H22ClFN2O3 — CID 17223887
N-(2-benzoyl-4-chlorophenyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide (PubChem CID 17223887) has the molecular formula C26H22ClFN2O3 and a molecular weight of 464.92 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17223887 |
| Molecular Formula | C26H22ClFN2O3 |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H22ClFN2O3/c27-20-8-11-23(22(16-20)24(31)17-4-2-1-3-5-17)29-25(32)18-12-14-30(15-13-18)26(33)19-6-9-21(28)10-7-19/h1-11,16,18H,12-15H2,(H,29,32) |
| InChIKey | MFDKKTJUZQBBET-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |