C20H19ClF2N2O2 — CID 113007286
N-(4-chloro-2-methylphenyl)-1-(3,4-difluorobenzoyl)piperidine-4-carboxamide (PubChem CID 113007286) has the molecular formula C20H19ClF2N2O2 and a molecular weight of 392.83 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-1-(3,4-difluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-1-(3,4-difluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113007286 |
| Molecular Formula | C20H19ClF2N2O2 |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-1-(3,4-difluorobenzoyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C1CCN(C(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H19ClF2N2O2/c1-12-10-15(21)3-5-18(12)24-19(26)13-6-8-25(9-7-13)20(27)14-2-4-16(22)17(23)11-14/h2-5,10-11,13H,6-9H2,1H3,(H,24,26) |
| InChIKey | IPOLVFPXRFTNQW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |