C20H21ClN2O3 — CID 9495612
1-(4-chlorobenzoyl)-N-(2-hydroxy-4-methylphenyl)piperidine-4-carboxamide (PubChem CID 9495612) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-(2-hydroxy-4-methylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-(2-hydroxy-4-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9495612 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-(2-hydroxy-4-methylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(C(=O)c3ccc(Cl)cc3)CC2)c(O)c1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-13-2-7-17(18(24)12-13)22-19(25)14-8-10-23(11-9-14)20(26)15-3-5-16(21)6-4-15/h2-7,12,14,24H,8-11H2,1H3,(H,22,25) |
| InChIKey | YBHRVRCQCKCLCG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|