C19H17Cl2N3O4 — CID 126058566
N-(2,4-dichlorophenyl)-1-(4-nitrobenzoyl)piperidine-4-carboxamide (PubChem CID 126058566) has the molecular formula C19H17Cl2N3O4 and a molecular weight of 422.27 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-(4-nitrobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-1-(4-nitrobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126058566 |
| Molecular Formula | C19H17Cl2N3O4 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-(4-nitrobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)C1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H17Cl2N3O4/c20-14-3-6-17(16(21)11-14)22-18(25)12-7-9-23(10-8-12)19(26)13-1-4-15(5-2-13)24(27)28/h1-6,11-12H,7-10H2,(H,22,25) |
| InChIKey | INERPXZCOHZMDP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|