C25H21Cl3N2O2 — CID 126069700
1-(4-phenylbenzoyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide (PubChem CID 126069700) has the molecular formula C25H21Cl3N2O2 and a molecular weight of 487.81 g/mol. Its IUPAC name is 1-(4-phenylbenzoyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-phenylbenzoyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126069700 |
| Molecular Formula | C25H21Cl3N2O2 |
| Molecular Weight | 487.81 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 1-(4-phenylbenzoyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1CCN(C(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H21Cl3N2O2/c26-20-14-22(28)23(15-21(20)27)29-24(31)18-10-12-30(13-11-18)25(32)19-8-6-17(7-9-19)16-4-2-1-3-5-16/h1-9,14-15,18H,10-13H2,(H,29,31) |
| InChIKey | KMHFNWVPYWWOKL-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.81 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|