C17H21Cl3N2O2 — CID 17224280
1-(2,2-dimethylpropanoyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide (PubChem CID 17224280) has the molecular formula C17H21Cl3N2O2 and a molecular weight of 391.73 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17224280 |
| Molecular Formula | C17H21Cl3N2O2 |
| Molecular Weight | 391.73 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCC(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H21Cl3N2O2/c1-17(2,3)16(24)22-6-4-10(5-7-22)15(23)21-14-9-12(19)11(18)8-13(14)20/h8-10H,4-7H2,1-3H3,(H,21,23) |
| InChIKey | RHHKJIHHFINONY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.73 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|