C17H15Cl3N2O3 — CID 17081680
1-(furan-2-carbonyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide (PubChem CID 17081680) has the molecular formula C17H15Cl3N2O3 and a molecular weight of 401.68 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17081680 |
| Molecular Formula | C17H15Cl3N2O3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-(2,4,5-trichlorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H15Cl3N2O3/c18-11-8-13(20)14(9-12(11)19)21-16(23)10-3-5-22(6-4-10)17(24)15-2-1-7-25-15/h1-2,7-10H,3-6H2,(H,21,23) |
| InChIKey | IJXGFOLHOPGJRP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|