C17H16Cl3N3O3 — CID 5205501
2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 5205501) has the molecular formula C17H16Cl3N3O3 and a molecular weight of 416.69 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 5205501 |
| Molecular Formula | C17H16Cl3N3O3 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccco2)CC1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl3N3O3/c18-11-8-13(20)14(9-12(11)19)21-16(24)10-22-3-5-23(6-4-22)17(25)15-2-1-7-26-15/h1-2,7-9H,3-6,10H2,(H,21,24) |
| InChIKey | ATGBFYOJPLTTIL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|