C18H19Cl2N3O3 — CID 109030220
N-(2,4-dichlorophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]propanamide (PubChem CID 109030220) has the molecular formula C18H19Cl2N3O3 and a molecular weight of 396.27 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]propanamide.
| Compound Name | N-(2,4-dichlorophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 109030220 |
| Molecular Formula | C18H19Cl2N3O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]propanamide |
| SMILES | O=C(CCN1CCN(C(=O)c2ccco2)CC1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O3/c19-13-3-4-15(14(20)12-13)21-17(24)5-6-22-7-9-23(10-8-22)18(25)16-2-1-11-26-16/h1-4,11-12H,5-10H2,(H,21,24) |
| InChIKey | BYUPHTSZYDOBSU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |