C17H18ClFN3O3+ — CID 8932693
N-(2-chloro-4-fluorophenyl)-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8932693) has the molecular formula C17H18ClFN3O3+ and a molecular weight of 366.80 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8932693 |
| Molecular Formula | C17H18ClFN3O3+ |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2ccco2)CC1)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H17ClFN3O3/c18-13-10-12(19)3-4-14(13)20-16(23)11-21-5-7-22(8-6-21)17(24)15-2-1-9-25-15/h1-4,9-10H,5-8,11H2,(H,20,23)/p+1 |
| InChIKey | AYGGPXZWARMKOH-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |