C18H19ClFN3O3 — CID 27154894
(2S)-N-(2-chloro-4-fluorophenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]propanamide (PubChem CID 27154894) has the molecular formula C18H19ClFN3O3 and a molecular weight of 379.82 g/mol. Its IUPAC name is (2S)-N-(2-chloro-4-fluorophenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-(2-chloro-4-fluorophenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 27154894 |
| Molecular Formula | C18H19ClFN3O3 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (2S)-N-(2-chloro-4-fluorophenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(F)cc1Cl)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H19ClFN3O3/c1-12(17(24)21-15-5-4-13(20)11-14(15)19)22-6-8-23(9-7-22)18(25)16-3-2-10-26-16/h2-5,10-12H,6-9H2,1H3,(H,21,24)/t12-/m0/s1 |
| InChIKey | AFFCUDBXRJCSBF-LBPRGKRZSA-N |
| XLogP | 2.86 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |