C17H19N3O3 — CID 773151
2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-phenylacetamide (PubChem CID 773151) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 773151 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccco2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C17H19N3O3/c21-16(18-14-5-2-1-3-6-14)13-19-8-10-20(11-9-19)17(22)15-7-4-12-23-15/h1-7,12H,8-11,13H2,(H,18,21) |
| InChIKey | ZUWTVEMVMSPCQG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |