C24H30N4O4 — CID 16589868
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-1-(furan-2-carbonyl)piperidine-4-carboxamide (PubChem CID 16589868) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-1-(furan-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16589868 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(CN1CCC(NC(=O)C2CCN(C(=O)c3ccco3)CC2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C24H30N4O4/c29-22(25-19-5-2-1-3-6-19)17-27-12-10-20(11-13-27)26-23(30)18-8-14-28(15-9-18)24(31)21-7-4-16-32-21/h1-7,16,18,20H,8-15,17H2,(H,25,29)(H,26,30) |
| InChIKey | JKVJGXKIELOVHO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |