C20H30N4O4S — CID 16613527
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 16613527) has the molecular formula C20H30N4O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16613527 |
| Molecular Formula | C20H30N4O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)NC2CCN(CC(=O)Nc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C20H30N4O4S/c1-29(27,28)24-13-7-16(8-14-24)20(26)22-18-9-11-23(12-10-18)15-19(25)21-17-5-3-2-4-6-17/h2-6,16,18H,7-15H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | BZUGYASZGYRPHK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |