C18H24FN3O2 — CID 165434114
N-[1-[2-(4-fluoroanilino)-2-oxoethyl]piperidin-4-yl]cyclobutanecarboxamide (PubChem CID 165434114) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[1-[2-(4-fluoroanilino)-2-oxoethyl]piperidin-4-yl]cyclobutanecarboxamide.
| Compound Name | N-[1-[2-(4-fluoroanilino)-2-oxoethyl]piperidin-4-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 165434114 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-[1-[2-(4-fluoroanilino)-2-oxoethyl]piperidin-4-yl]cyclobutanecarboxamide |
| SMILES | O=C(CN1CCC(NC(=O)C2CCC2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FN3O2/c19-14-4-6-15(7-5-14)20-17(23)12-22-10-8-16(9-11-22)21-18(24)13-2-1-3-13/h4-7,13,16H,1-3,8-12H2,(H,20,23)(H,21,24) |
| InChIKey | YCFJPBHJGYDSPS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |