C20H27Cl2N3O2 — CID 16909920
N-cyclohexyl-1-[2-(3,4-dichloroanilino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 16909920) has the molecular formula C20H27Cl2N3O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is N-cyclohexyl-1-[2-(3,4-dichloroanilino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-cyclohexyl-1-[2-(3,4-dichloroanilino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16909920 |
| Molecular Formula | C20H27Cl2N3O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-cyclohexyl-1-[2-(3,4-dichloroanilino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | O=C(CN1CCC(C(=O)NC2CCCCC2)CC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H27Cl2N3O2/c21-17-7-6-16(12-18(17)22)23-19(26)13-25-10-8-14(9-11-25)20(27)24-15-4-2-1-3-5-15/h6-7,12,14-15H,1-5,8-11,13H2,(H,23,26)(H,24,27) |
| InChIKey | PLAMAXLIVQCEPB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |