C22H26FN3O3 — CID 16909487
N-(4-ethoxyphenyl)-1-[2-(4-fluoroanilino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 16909487) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1-[2-(4-fluoroanilino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-1-[2-(4-fluoroanilino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16909487 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-(4-ethoxyphenyl)-1-[2-(4-fluoroanilino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CCN(CC(=O)Nc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26FN3O3/c1-2-29-20-9-7-19(8-10-20)25-22(28)16-11-13-26(14-12-16)15-21(27)24-18-5-3-17(23)4-6-18/h3-10,16H,2,11-15H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | HALDZELBOXVCAD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |