C18H24BrN3O2 — CID 37466938
N-[1-[2-(4-bromo-3-methylanilino)-2-oxoethyl]piperidin-4-yl]cyclopropanecarboxamide (PubChem CID 37466938) has the molecular formula C18H24BrN3O2 and a molecular weight of 394.31 g/mol. Its IUPAC name is N-[1-[2-(4-bromo-3-methylanilino)-2-oxoethyl]piperidin-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-[2-(4-bromo-3-methylanilino)-2-oxoethyl]piperidin-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 37466938 |
| Molecular Formula | C18H24BrN3O2 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[1-[2-(4-bromo-3-methylanilino)-2-oxoethyl]piperidin-4-yl]cyclopropanecarboxamide |
| SMILES | Cc1cc(NC(=O)CN2CCC(NC(=O)C3CC3)CC2)ccc1Br |
| InChI | InChI=1S/C18H24BrN3O2/c1-12-10-15(4-5-16(12)19)20-17(23)11-22-8-6-14(7-9-22)21-18(24)13-2-3-13/h4-5,10,13-14H,2-3,6-9,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | FBMPCUIWCGVUNI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |