C18H19F2N3O4 — CID 8932791
N-[4-(difluoromethoxy)phenyl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide (PubChem CID 8932791) has the molecular formula C18H19F2N3O4 and a molecular weight of 379.36 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8932791 |
| Molecular Formula | C18H19F2N3O4 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccco2)CC1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H19F2N3O4/c19-18(20)27-14-5-3-13(4-6-14)21-16(24)12-22-7-9-23(10-8-22)17(25)15-2-1-11-26-15/h1-6,11,18H,7-10,12H2,(H,21,24) |
| InChIKey | IUGPNLDWAKWXGR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |