C21H23F2N3O3 — CID 34435186
2-[4-[2-[4-(difluoromethoxy)phenyl]acetyl]piperazin-1-yl]-N-phenylacetamide (PubChem CID 34435186) has the molecular formula C21H23F2N3O3 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-[4-[2-[4-(difluoromethoxy)phenyl]acetyl]piperazin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[2-[4-(difluoromethoxy)phenyl]acetyl]piperazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 34435186 |
| Molecular Formula | C21H23F2N3O3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-[4-[2-[4-(difluoromethoxy)phenyl]acetyl]piperazin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1CCN(C(=O)Cc2ccc(OC(F)F)cc2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C21H23F2N3O3/c22-21(23)29-18-8-6-16(7-9-18)14-20(28)26-12-10-25(11-13-26)15-19(27)24-17-4-2-1-3-5-17/h1-9,21H,10-15H2,(H,24,27) |
| InChIKey | ZGMHZJZMNSCBCN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |