C18H26F2N4O2S — CID 9213724
N-tert-butyl-2-[4-[[4-(difluoromethoxy)phenyl]carbamothioyl]piperazin-1-yl]acetamide (PubChem CID 9213724) has the molecular formula C18H26F2N4O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[4-(difluoromethoxy)phenyl]carbamothioyl]piperazin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[[4-(difluoromethoxy)phenyl]carbamothioyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9213724 |
| Molecular Formula | C18H26F2N4O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-tert-butyl-2-[4-[[4-(difluoromethoxy)phenyl]carbamothioyl]piperazin-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCN(C(=S)Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H26F2N4O2S/c1-18(2,3)22-15(25)12-23-8-10-24(11-9-23)17(27)21-13-4-6-14(7-5-13)26-16(19)20/h4-7,16H,8-12H2,1-3H3,(H,21,27)(H,22,25) |
| InChIKey | CNZRDXNCKWQQLM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|