C14H17F2N3O2S — CID 7943164
1-[[4-(difluoromethoxy)phenyl]carbamothioyl]piperidine-4-carboxamide (PubChem CID 7943164) has the molecular formula C14H17F2N3O2S and a molecular weight of 329.37 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]carbamothioyl]piperidine-4-carboxamide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]carbamothioyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7943164 |
| Molecular Formula | C14H17F2N3O2S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]carbamothioyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=S)Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C14H17F2N3O2S/c15-13(16)21-11-3-1-10(2-4-11)18-14(22)19-7-5-9(6-8-19)12(17)20/h1-4,9,13H,5-8H2,(H2,17,20)(H,18,22) |
| InChIKey | KBXAUDCCVMMDTR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|