C13H14F2N2O2S — CID 80592420
1-carbamothioyl-N-[4-(difluoromethoxy)phenyl]cyclobutane-1-carboxamide (PubChem CID 80592420) has the molecular formula C13H14F2N2O2S and a molecular weight of 300.33 g/mol. Its IUPAC name is 1-carbamothioyl-N-[4-(difluoromethoxy)phenyl]cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-[4-(difluoromethoxy)phenyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80592420 |
| Molecular Formula | C13H14F2N2O2S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-carbamothioyl-N-[4-(difluoromethoxy)phenyl]cyclobutane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2ccc(OC(F)F)cc2)CCC1 |
| InChI | InChI=1S/C13H14F2N2O2S/c14-12(15)19-9-4-2-8(3-5-9)17-11(18)13(10(16)20)6-1-7-13/h2-5,12H,1,6-7H2,(H2,16,20)(H,17,18) |
| InChIKey | WJGFJXJXHMWALK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|