C19H18BrF2NO2 — CID 18291480
1-(4-bromophenyl)-N-[4-(difluoromethoxy)phenyl]cyclopentane-1-carboxamide (PubChem CID 18291480) has the molecular formula C19H18BrF2NO2 and a molecular weight of 410.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[4-(difluoromethoxy)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[4-(difluoromethoxy)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 18291480 |
| Molecular Formula | C19H18BrF2NO2 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 1-(4-bromophenyl)-N-[4-(difluoromethoxy)phenyl]cyclopentane-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)C1(c2ccc(Br)cc2)CCCC1 |
| InChI | InChI=1S/C19H18BrF2NO2/c20-14-5-3-13(4-6-14)19(11-1-2-12-19)17(24)23-15-7-9-16(10-8-15)25-18(21)22/h3-10,18H,1-2,11-12H2,(H,23,24) |
| InChIKey | ONJRJSFJXGGTLP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |