C20H20BrNO3 — CID 18277869
methyl 4-[[1-(4-bromophenyl)cyclopentanecarbonyl]amino]benzoate (PubChem CID 18277869) has the molecular formula C20H20BrNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is methyl 4-[[1-(4-bromophenyl)cyclopentanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-[[1-(4-bromophenyl)cyclopentanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 18277869 |
| Molecular Formula | C20H20BrNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | methyl 4-[[1-(4-bromophenyl)cyclopentanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2(c3ccc(Br)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C20H20BrNO3/c1-25-18(23)14-4-10-17(11-5-14)22-19(24)20(12-2-3-13-20)15-6-8-16(21)9-7-15/h4-11H,2-3,12-13H2,1H3,(H,22,24) |
| InChIKey | GTSZXRLEDNTPFF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |