C18H15BrClNO3 — CID 52555670
methyl 3-[[1-(4-bromophenyl)cyclopropanecarbonyl]amino]-4-chlorobenzoate (PubChem CID 52555670) has the molecular formula C18H15BrClNO3 and a molecular weight of 408.68 g/mol. Its IUPAC name is methyl 3-[[1-(4-bromophenyl)cyclopropanecarbonyl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[[1-(4-bromophenyl)cyclopropanecarbonyl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 52555670 |
| Molecular Formula | C18H15BrClNO3 |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | methyl 3-[[1-(4-bromophenyl)cyclopropanecarbonyl]amino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2(c3ccc(Br)cc3)CC2)c1 |
| InChI | InChI=1S/C18H15BrClNO3/c1-24-16(22)11-2-7-14(20)15(10-11)21-17(23)18(8-9-18)12-3-5-13(19)6-4-12/h2-7,10H,8-9H2,1H3,(H,21,23) |
| InChIKey | VYRKBLJNVQLBMQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |