C21H26ClNO3 — CID 2886759
methyl 4-chloro-3-[(3,5-dimethyladamantane-1-carbonyl)amino]benzoate (PubChem CID 2886759) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is methyl 4-chloro-3-[(3,5-dimethyladamantane-1-carbonyl)amino]benzoate.
| Compound Name | methyl 4-chloro-3-[(3,5-dimethyladamantane-1-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 2886759 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | methyl 4-chloro-3-[(3,5-dimethyladamantane-1-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H26ClNO3/c1-19-7-13-8-20(2,10-19)12-21(9-13,11-19)18(25)23-16-6-14(17(24)26-3)4-5-15(16)22/h4-6,13H,7-12H2,1-3H3,(H,23,25) |
| InChIKey | SCWNEIFPSHVLRS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |