C19H23Cl2NO — CID 2130210
(3R,5S)-N-(2,5-dichlorophenyl)-3,5-dimethyladamantane-1-carboxamide (PubChem CID 2130210) has the molecular formula C19H23Cl2NO and a molecular weight of 352.31 g/mol. Its IUPAC name is (3R,5S)-N-(2,5-dichlorophenyl)-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | (3R,5S)-N-(2,5-dichlorophenyl)-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 2130210 |
| Molecular Formula | C19H23Cl2NO |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (3R,5S)-N-(2,5-dichlorophenyl)-3,5-dimethyladamantane-1-carboxamide |
| SMILES | C[C@]12CC3CC(C(=O)Nc4cc(Cl)ccc4Cl)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C19H23Cl2NO/c1-17-6-12-7-18(2,9-17)11-19(8-12,10-17)16(23)22-15-5-13(20)3-4-14(15)21/h3-5,12H,6-11H2,1-2H3,(H,22,23)/t12?,17-,18+,19? |
| InChIKey | JGWUPSJJJAZNTM-CMXJYWLISA-N |
| XLogP | 5.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |