C24H25Cl2NO — CID 2379502
(5S,7R)-N-(2,5-dichlorophenyl)-3-(4-methylphenyl)adamantane-1-carboxamide (PubChem CID 2379502) has the molecular formula C24H25Cl2NO and a molecular weight of 414.38 g/mol. Its IUPAC name is (5S,7R)-N-(2,5-dichlorophenyl)-3-(4-methylphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-(2,5-dichlorophenyl)-3-(4-methylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 2379502 |
| Molecular Formula | C24H25Cl2NO |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (5S,7R)-N-(2,5-dichlorophenyl)-3-(4-methylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)Nc5cc(Cl)ccc5Cl)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H25Cl2NO/c1-15-2-4-18(5-3-15)23-10-16-8-17(11-23)13-24(12-16,14-23)22(28)27-21-9-19(25)6-7-20(21)26/h2-7,9,16-17H,8,10-14H2,1H3,(H,27,28)/t16-,17+,23?,24? |
| InChIKey | RKHGNDOZLYTNCV-UPFYTXMWSA-N |
| XLogP | 6.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |