C25H29NO3S — CID 55416136
3-(4-methylphenyl)-N-(3-methylsulfonylphenyl)adamantane-1-carboxamide (PubChem CID 55416136) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-(3-methylsulfonylphenyl)adamantane-1-carboxamide.
| Compound Name | 3-(4-methylphenyl)-N-(3-methylsulfonylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55416136 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 3-(4-methylphenyl)-N-(3-methylsulfonylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)Nc5cccc(S(C)(=O)=O)c5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H29NO3S/c1-17-6-8-20(9-7-17)24-12-18-10-19(13-24)15-25(14-18,16-24)23(27)26-21-4-3-5-22(11-21)30(2,28)29/h3-9,11,18-19H,10,12-16H2,1-2H3,(H,26,27) |
| InChIKey | YMHIKTZNTWNKCD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |