C26H31N3O2 — CID 146088249
N-[3-(carbamoylamino)phenyl]-3-(3,4-dimethylphenyl)adamantane-1-carboxamide (PubChem CID 146088249) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-3-(3,4-dimethylphenyl)adamantane-1-carboxamide.
| Compound Name | N-[3-(carbamoylamino)phenyl]-3-(3,4-dimethylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 146088249 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-3-(3,4-dimethylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)Nc5cccc(NC(N)=O)c5)(C4)C2)C3)cc1C |
| InChI | InChI=1S/C26H31N3O2/c1-16-6-7-20(8-17(16)2)25-11-18-9-19(12-25)14-26(13-18,15-25)23(30)28-21-4-3-5-22(10-21)29-24(27)31/h3-8,10,18-19H,9,11-15H2,1-2H3,(H,28,30)(H3,27,29,31) |
| InChIKey | FCJQXQWVRIKRJQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |