C19H24O2 — CID 1250843
(5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid (PubChem CID 1250843) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid.
| Compound Name | (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 1250843 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)O)(C4)C2)C3)cc1C |
| InChI | InChI=1S/C19H24O2/c1-12-3-4-16(5-13(12)2)18-7-14-6-15(8-18)10-19(9-14,11-18)17(20)21/h3-5,14-15H,6-11H2,1-2H3,(H,20,21)/t14-,15+,18?,19? |
| InChIKey | OSUAHUMJPBHFKV-MYMYQCDVSA-N |
| XLogP | 4.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |