(5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid

C19H24O2 — CID 1250843

IUPAC(5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid
SMILESCc1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)O)(C4)C2)C3)cc1C
InChIInChI=1S/C19H24O2/c1-12-3-4-16(5-13(12)2)18-7-14-6-15(8-18)10-19(9-14,11-18)17(20)21/h3-5,14-15H,6-11H2,1-2H3,(H,20,21)/t14-,15+,18?,19?
InChIKeyOSUAHUMJPBHFKV-MYMYQCDVSA-N
MW284.40 g/mol
LogP4.23
Rot. Bonds2

About (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid

(5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid (PubChem CID 1250843) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid.

Molecular Properties

Compound Name(5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid
PubChem CID1250843
Molecular FormulaC19H24O2
Molecular Weight284.40 g/mol
Exact Mass284.18
IUPAC Name(5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid
SMILESCc1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)O)(C4)C2)C3)cc1C
InChIInChI=1S/C19H24O2/c1-12-3-4-16(5-13(12)2)18-7-14-6-15(8-18)10-19(9-14,11-18)17(20)21/h3-5,14-15H,6-11H2,1-2H3,(H,20,21)/t14-,15+,18?,19?
InChIKeyOSUAHUMJPBHFKV-MYMYQCDVSA-N
XLogP4.23
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.40
LogP ≤ 54.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid?
The IUPAC name of (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid (CID 1250843) is (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid.
What is the SMILES notation for (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid?
The canonical SMILES for (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid is Cc1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)O)(C4)C2)C3)cc1C.
What is the InChIKey of (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid?
The InChIKey is OSUAHUMJPBHFKV-MYMYQCDVSA-N. The full InChI is InChI=1S/C19H24O2/c1-12-3-4-16(5-13(12)2)18-7-14-6-15(8-18)10-19(9-14,11-18)17(20)21/h3-5,14-15H,6-11H2,1-2H3,(H,20,21)/t14-,15+,18?,19?.
What are the key properties of (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid?
(5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid has a molecular weight of 284.40 g/mol, XLogP of 4.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid is sourced from PubChem (CID 1250843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).