C34H38O4 — CID 14511576
3-[4-[4-(3-carboxy-1-adamantyl)phenyl]phenyl]adamantane-1-carboxylic acid (PubChem CID 14511576) has the molecular formula C34H38O4 and a molecular weight of 510.67 g/mol. Its IUPAC name is 3-[4-[4-(3-carboxy-1-adamantyl)phenyl]phenyl]adamantane-1-carboxylic acid.
| Compound Name | 3-[4-[4-(3-carboxy-1-adamantyl)phenyl]phenyl]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 14511576 |
| Molecular Formula | C34H38O4 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 3-[4-[4-(3-carboxy-1-adamantyl)phenyl]phenyl]adamantane-1-carboxylic acid |
| SMILES | O=C(O)C12CC3CC(C1)CC(c1ccc(-c4ccc(C56CC7CC(CC(C(=O)O)(C7)C5)C6)cc4)cc1)(C3)C2 |
| InChI | InChI=1S/C34H38O4/c35-29(36)33-15-21-9-22(16-33)12-31(11-21,19-33)27-5-1-25(2-6-27)26-3-7-28(8-4-26)32-13-23-10-24(14-32)18-34(17-23,20-32)30(37)38/h1-8,21-24H,9-20H2,(H,35,36)(H,37,38) |
| InChIKey | FCZFCSJOORBWOX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |